C21H17N3O5 — CID 4541590
(1,3-dioxoisoindol-2-yl)methyl 4-oxo-3-propan-2-ylphthalazine-1-carboxylate (PubChem CID 4541590) has the molecular formula C21H17N3O5 and a molecular weight of 391.38 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 4-oxo-3-propan-2-ylphthalazine-1-carboxylate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 4-oxo-3-propan-2-ylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 4541590 |
| Molecular Formula | C21H17N3O5 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 4-oxo-3-propan-2-ylphthalazine-1-carboxylate |
| SMILES | CC(C)n1nc(C(=O)OCN2C(=O)c3ccccc3C2=O)c2ccccc2c1=O |
| InChI | InChI=1S/C21H17N3O5/c1-12(2)24-20(27)14-8-4-3-7-13(14)17(22-24)21(28)29-11-23-18(25)15-9-5-6-10-16(15)19(23)26/h3-10,12H,11H2,1-2H3 |
| InChIKey | VGEOJUFOKDAEQS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 98.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|