C22H23N3O4 — CID 2534802
[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl] 4-oxo-3-propan-2-ylphthalazine-1-carboxylate (PubChem CID 2534802) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is [2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl] 4-oxo-3-propan-2-ylphthalazine-1-carboxylate.
| Compound Name | [2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl] 4-oxo-3-propan-2-ylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 2534802 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | [2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl] 4-oxo-3-propan-2-ylphthalazine-1-carboxylate |
| SMILES | CC(C)n1nc(C(=O)OCC(=O)N[C@@H](C)c2ccccc2)c2ccccc2c1=O |
| InChI | InChI=1S/C22H23N3O4/c1-14(2)25-21(27)18-12-8-7-11-17(18)20(24-25)22(28)29-13-19(26)23-15(3)16-9-5-4-6-10-16/h4-12,14-15H,13H2,1-3H3,(H,23,26)/t15-/m0/s1 |
| InChIKey | LFWAEQCPHDLNLQ-HNNXBMFYSA-N |
| XLogP | 3.01 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |