C19H19N3O4S — CID 3634669
[2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 4-oxo-3-propan-2-ylphthalazine-1-carboxylate (PubChem CID 3634669) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 4-oxo-3-propan-2-ylphthalazine-1-carboxylate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 4-oxo-3-propan-2-ylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 3634669 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 4-oxo-3-propan-2-ylphthalazine-1-carboxylate |
| SMILES | CC(C)n1nc(C(=O)OCC(=O)NCc2cccs2)c2ccccc2c1=O |
| InChI | InChI=1S/C19H19N3O4S/c1-12(2)22-18(24)15-8-4-3-7-14(15)17(21-22)19(25)26-11-16(23)20-10-13-6-5-9-27-13/h3-9,12H,10-11H2,1-2H3,(H,20,23) |
| InChIKey | RDXHJUYMMHWCQL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |