C23H26N2O5 — CID 55325633
2-(4-propoxyphenoxy)ethyl 4-oxo-3-propan-2-ylphthalazine-1-carboxylate (PubChem CID 55325633) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is 2-(4-propoxyphenoxy)ethyl 4-oxo-3-propan-2-ylphthalazine-1-carboxylate.
| Compound Name | 2-(4-propoxyphenoxy)ethyl 4-oxo-3-propan-2-ylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 55325633 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2-(4-propoxyphenoxy)ethyl 4-oxo-3-propan-2-ylphthalazine-1-carboxylate |
| SMILES | CCCOc1ccc(OCCOC(=O)c2nn(C(C)C)c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C23H26N2O5/c1-4-13-28-17-9-11-18(12-10-17)29-14-15-30-23(27)21-19-7-5-6-8-20(19)22(26)25(24-21)16(2)3/h5-12,16H,4,13-15H2,1-3H3 |
| InChIKey | VEBFBSTUMOKWMG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|