C20H18Cl2N2O4 — CID 46795464
2-(2,6-dichlorophenoxy)ethyl 4-oxo-3-propan-2-ylphthalazine-1-carboxylate (PubChem CID 46795464) has the molecular formula C20H18Cl2N2O4 and a molecular weight of 421.28 g/mol. Its IUPAC name is 2-(2,6-dichlorophenoxy)ethyl 4-oxo-3-propan-2-ylphthalazine-1-carboxylate.
| Compound Name | 2-(2,6-dichlorophenoxy)ethyl 4-oxo-3-propan-2-ylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 46795464 |
| Molecular Formula | C20H18Cl2N2O4 |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 2-(2,6-dichlorophenoxy)ethyl 4-oxo-3-propan-2-ylphthalazine-1-carboxylate |
| SMILES | CC(C)n1nc(C(=O)OCCOc2c(Cl)cccc2Cl)c2ccccc2c1=O |
| InChI | InChI=1S/C20H18Cl2N2O4/c1-12(2)24-19(25)14-7-4-3-6-13(14)17(23-24)20(26)28-11-10-27-18-15(21)8-5-9-16(18)22/h3-9,12H,10-11H2,1-2H3 |
| InChIKey | SKNVIKXOPHYDNK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|