C22H20N2O4 — CID 86953820
(3-methyl-1-benzofuran-2-yl)methyl 4-oxo-3-propan-2-ylphthalazine-1-carboxylate (PubChem CID 86953820) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is (3-methyl-1-benzofuran-2-yl)methyl 4-oxo-3-propan-2-ylphthalazine-1-carboxylate.
| Compound Name | (3-methyl-1-benzofuran-2-yl)methyl 4-oxo-3-propan-2-ylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 86953820 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | (3-methyl-1-benzofuran-2-yl)methyl 4-oxo-3-propan-2-ylphthalazine-1-carboxylate |
| SMILES | Cc1c(COC(=O)c2nn(C(C)C)c(=O)c3ccccc23)oc2ccccc12 |
| InChI | InChI=1S/C22H20N2O4/c1-13(2)24-21(25)17-10-5-4-9-16(17)20(23-24)22(26)27-12-19-14(3)15-8-6-7-11-18(15)28-19/h4-11,13H,12H2,1-3H3 |
| InChIKey | QRPKVXRZEDAILO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |