About (2-methylphenyl) 4-oxo-3-propan-2-ylphthalazine-1-carboxylate
(2-methylphenyl) 4-oxo-3-propan-2-ylphthalazine-1-carboxylate (PubChem CID 78776939) has the molecular formula C19H18N2O3
and a molecular weight of 322.36 g/mol. Its IUPAC name is (2-methylphenyl) 4-oxo-3-propan-2-ylphthalazine-1-carboxylate.
Molecular Properties
| Compound Name | (2-methylphenyl) 4-oxo-3-propan-2-ylphthalazine-1-carboxylate |
| PubChem CID | 78776939 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | (2-methylphenyl) 4-oxo-3-propan-2-ylphthalazine-1-carboxylate |
| SMILES | Cc1ccccc1OC(=O)c1nn(C(C)C)c(=O)c2ccccc12 |
| InChI | InChI=1S/C19H18N2O3/c1-12(2)21-18(22)15-10-6-5-9-14(15)17(20-21)19(23)24-16-11-7-4-8-13(16)3/h4-12H,1-3H3 |
| InChIKey | XLBRZPDKCYNRCK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-methylphenyl) 4-oxo-3-propan-2-ylphthalazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylphenyl) 4-oxo-3-propan-2-ylphthalazine-1-carboxylate?
The IUPAC name of (2-methylphenyl) 4-oxo-3-propan-2-ylphthalazine-1-carboxylate (CID 78776939) is (2-methylphenyl) 4-oxo-3-propan-2-ylphthalazine-1-carboxylate.
What is the SMILES notation for (2-methylphenyl) 4-oxo-3-propan-2-ylphthalazine-1-carboxylate?
The canonical SMILES for (2-methylphenyl) 4-oxo-3-propan-2-ylphthalazine-1-carboxylate is Cc1ccccc1OC(=O)c1nn(C(C)C)c(=O)c2ccccc12.
What is the InChIKey of (2-methylphenyl) 4-oxo-3-propan-2-ylphthalazine-1-carboxylate?
The InChIKey is XLBRZPDKCYNRCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O3/c1-12(2)21-18(22)15-10-6-5-9-14(15)17(20-21)19(23)24-16-11-7-4-8-13(16)3/h4-12H,1-3H3.
What are the key properties of (2-methylphenyl) 4-oxo-3-propan-2-ylphthalazine-1-carboxylate?
(2-methylphenyl) 4-oxo-3-propan-2-ylphthalazine-1-carboxylate has a molecular weight of 322.36 g/mol, XLogP of 3.51, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylphenyl) 4-oxo-3-propan-2-ylphthalazine-1-carboxylate is sourced from PubChem (CID 78776939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).