C20H20N2O3 — CID 51146939
(2,4-dimethylphenyl) 4-oxo-3-propan-2-ylphthalazine-1-carboxylate (PubChem CID 51146939) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is (2,4-dimethylphenyl) 4-oxo-3-propan-2-ylphthalazine-1-carboxylate.
| Compound Name | (2,4-dimethylphenyl) 4-oxo-3-propan-2-ylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 51146939 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (2,4-dimethylphenyl) 4-oxo-3-propan-2-ylphthalazine-1-carboxylate |
| SMILES | Cc1ccc(OC(=O)c2nn(C(C)C)c(=O)c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C20H20N2O3/c1-12(2)22-19(23)16-8-6-5-7-15(16)18(21-22)20(24)25-17-10-9-13(3)11-14(17)4/h5-12H,1-4H3 |
| InChIKey | MVBYOKSPAHMIRN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|