C21H19F3N2O6S — CID 42972090
(1,3-dioxoisoindol-2-yl)methyl 3-methyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanoate (PubChem CID 42972090) has the molecular formula C21H19F3N2O6S and a molecular weight of 484.45 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 3-methyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanoate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 3-methyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanoate |
|---|---|
| PubChem CID | 42972090 |
| Molecular Formula | C21H19F3N2O6S |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 3-methyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]butanoate |
| SMILES | CC(C)C(NS(=O)(=O)c1cccc(C(F)(F)F)c1)C(=O)OCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H19F3N2O6S/c1-12(2)17(25-33(30,31)14-7-5-6-13(10-14)21(22,23)24)20(29)32-11-26-18(27)15-8-3-4-9-16(15)19(26)28/h3-10,12,17,25H,11H2,1-2H3 |
| InChIKey | WNIFCGOQKHBELS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|