C21H22N2O6S — CID 4650761
2-(1,3-dioxoisoindol-2-yl)ethyl 2-(benzenesulfonamido)-3-methylbutanoate (PubChem CID 4650761) has the molecular formula C21H22N2O6S and a molecular weight of 430.48 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 2-(benzenesulfonamido)-3-methylbutanoate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-(benzenesulfonamido)-3-methylbutanoate |
|---|---|
| PubChem CID | 4650761 |
| Molecular Formula | C21H22N2O6S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-(benzenesulfonamido)-3-methylbutanoate |
| SMILES | CC(C)C(NS(=O)(=O)c1ccccc1)C(=O)OCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H22N2O6S/c1-14(2)18(22-30(27,28)15-8-4-3-5-9-15)21(26)29-13-12-23-19(24)16-10-6-7-11-17(16)20(23)25/h3-11,14,18,22H,12-13H2,1-2H3 |
| InChIKey | FOXONBBICIVCEG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|