C13H15F3NO4S- — CID 2341191
(2S,3R)-3-methyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]pentanoate (PubChem CID 2341191) has the molecular formula C13H15F3NO4S- and a molecular weight of 338.33 g/mol. Its IUPAC name is (2S,3R)-3-methyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]pentanoate.
| Compound Name | (2S,3R)-3-methyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]pentanoate |
|---|---|
| PubChem CID | 2341191 |
| Molecular Formula | C13H15F3NO4S- |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | (2S,3R)-3-methyl-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]pentanoate |
| SMILES | CC[C@@H](C)[C@H](NS(=O)(=O)c1cccc(C(F)(F)F)c1)C(=O)[O-] |
| InChI | InChI=1S/C13H16F3NO4S/c1-3-8(2)11(12(18)19)17-22(20,21)10-6-4-5-9(7-10)13(14,15)16/h4-8,11,17H,3H2,1-2H3,(H,18,19)/p-1/t8-,11+/m1/s1 |
| InChIKey | KZQQUBYIRNCQIL-KCJUWKMLSA-M |
| XLogP | 1.15 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |