C12H14F3NO4S — CID 104935432
(2R)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]pentanoic acid (PubChem CID 104935432) has the molecular formula C12H14F3NO4S and a molecular weight of 325.31 g/mol. Its IUPAC name is (2R)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]pentanoic acid.
| Compound Name | (2R)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]pentanoic acid |
|---|---|
| PubChem CID | 104935432 |
| Molecular Formula | C12H14F3NO4S |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | (2R)-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]pentanoic acid |
| SMILES | CCC[C@@H](NS(=O)(=O)c1cccc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C12H14F3NO4S/c1-2-4-10(11(17)18)16-21(19,20)9-6-3-5-8(7-9)12(13,14)15/h3,5-7,10,16H,2,4H2,1H3,(H,17,18)/t10-/m1/s1 |
| InChIKey | YKTFUBPLDVHNOX-SNVBAGLBSA-N |
| XLogP | 2.24 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |