C20H16N2O4 — CID 5207428
(1,3-dioxoisoindol-2-yl)methyl 3-(1H-indol-3-yl)propanoate (PubChem CID 5207428) has the molecular formula C20H16N2O4 and a molecular weight of 348.36 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 3-(1H-indol-3-yl)propanoate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 5207428 |
| Molecular Formula | C20H16N2O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 3-(1H-indol-3-yl)propanoate |
| SMILES | O=C(CCc1c[nH]c2ccccc12)OCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H16N2O4/c23-18(10-9-13-11-21-17-8-4-3-5-14(13)17)26-12-22-19(24)15-6-1-2-7-16(15)20(22)25/h1-8,11,21H,9-10,12H2 |
| InChIKey | CGBPJVBSUDKFTJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|