C19H17Cl2NO3 — CID 2472474
2-(2,6-dichlorophenoxy)ethyl 3-(1H-indol-3-yl)propanoate (PubChem CID 2472474) has the molecular formula C19H17Cl2NO3 and a molecular weight of 378.26 g/mol. Its IUPAC name is 2-(2,6-dichlorophenoxy)ethyl 3-(1H-indol-3-yl)propanoate.
| Compound Name | 2-(2,6-dichlorophenoxy)ethyl 3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 2472474 |
| Molecular Formula | C19H17Cl2NO3 |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 2-(2,6-dichlorophenoxy)ethyl 3-(1H-indol-3-yl)propanoate |
| SMILES | O=C(CCc1c[nH]c2ccccc12)OCCOc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H17Cl2NO3/c20-15-5-3-6-16(21)19(15)25-11-10-24-18(23)9-8-13-12-22-17-7-2-1-4-14(13)17/h1-7,12,22H,8-11H2 |
| InChIKey | BPIVYOLGDPMLLZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|