C21H21ClN2O3 — CID 55418939
[1-[(2-chlorophenyl)methylamino]-1-oxopropan-2-yl] 3-(1H-indol-3-yl)propanoate (PubChem CID 55418939) has the molecular formula C21H21ClN2O3 and a molecular weight of 384.86 g/mol. Its IUPAC name is [1-[(2-chlorophenyl)methylamino]-1-oxopropan-2-yl] 3-(1H-indol-3-yl)propanoate.
| Compound Name | [1-[(2-chlorophenyl)methylamino]-1-oxopropan-2-yl] 3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 55418939 |
| Molecular Formula | C21H21ClN2O3 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | [1-[(2-chlorophenyl)methylamino]-1-oxopropan-2-yl] 3-(1H-indol-3-yl)propanoate |
| SMILES | CC(OC(=O)CCc1c[nH]c2ccccc12)C(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C21H21ClN2O3/c1-14(21(26)24-13-16-6-2-4-8-18(16)22)27-20(25)11-10-15-12-23-19-9-5-3-7-17(15)19/h2-9,12,14,23H,10-11,13H2,1H3,(H,24,26) |
| InChIKey | BDKRFYFLWJNULO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |