C21H24ClNO4 — CID 9384511
[(2R)-1-[(2-chlorophenyl)methylamino]-1-oxopropan-2-yl] 3-(2-ethoxyphenyl)propanoate (PubChem CID 9384511) has the molecular formula C21H24ClNO4 and a molecular weight of 389.88 g/mol. Its IUPAC name is [(2R)-1-[(2-chlorophenyl)methylamino]-1-oxopropan-2-yl] 3-(2-ethoxyphenyl)propanoate.
| Compound Name | [(2R)-1-[(2-chlorophenyl)methylamino]-1-oxopropan-2-yl] 3-(2-ethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 9384511 |
| Molecular Formula | C21H24ClNO4 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | [(2R)-1-[(2-chlorophenyl)methylamino]-1-oxopropan-2-yl] 3-(2-ethoxyphenyl)propanoate |
| SMILES | CCOc1ccccc1CCC(=O)O[C@H](C)C(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C21H24ClNO4/c1-3-26-19-11-7-5-8-16(19)12-13-20(24)27-15(2)21(25)23-14-17-9-4-6-10-18(17)22/h4-11,15H,3,12-14H2,1-2H3,(H,23,25)/t15-/m1/s1 |
| InChIKey | LIHVFNAVJDKAID-OAHLLOKOSA-N |
| XLogP | 3.92 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |