C23H30N2O3 — CID 7958610
[(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 4-(1H-indol-3-yl)butanoate (PubChem CID 7958610) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 4-(1H-indol-3-yl)butanoate.
| Compound Name | [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 4-(1H-indol-3-yl)butanoate |
|---|---|
| PubChem CID | 7958610 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 4-(1H-indol-3-yl)butanoate |
| SMILES | C[C@H](OC(=O)CCCc1c[nH]c2ccccc12)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C23H30N2O3/c1-17(23(27)24-15-14-18-8-3-2-4-9-18)28-22(26)13-7-10-19-16-25-21-12-6-5-11-20(19)21/h5-6,8,11-12,16-17,25H,2-4,7,9-10,13-15H2,1H3,(H,24,27)/t17-/m0/s1 |
| InChIKey | UNWVOZHXNIGAAI-KRWDZBQOSA-N |
| XLogP | 4.43 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|