C20H26FNO5S — CID 7624090
[(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 3-(4-fluorophenyl)sulfonylpropanoate (PubChem CID 7624090) has the molecular formula C20H26FNO5S and a molecular weight of 411.50 g/mol. Its IUPAC name is [(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 3-(4-fluorophenyl)sulfonylpropanoate.
| Compound Name | [(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 3-(4-fluorophenyl)sulfonylpropanoate |
|---|---|
| PubChem CID | 7624090 |
| Molecular Formula | C20H26FNO5S |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | [(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 3-(4-fluorophenyl)sulfonylpropanoate |
| SMILES | C[C@@H](OC(=O)CCS(=O)(=O)c1ccc(F)cc1)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C20H26FNO5S/c1-15(20(24)22-13-11-16-5-3-2-4-6-16)27-19(23)12-14-28(25,26)18-9-7-17(21)8-10-18/h5,7-10,15H,2-4,6,11-14H2,1H3,(H,22,24)/t15-/m1/s1 |
| InChIKey | HRXGNUXKLADOTF-OAHLLOKOSA-N |
| XLogP | 2.93 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|