C21H31FN3O3S+ — CID 8688198
(2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-[4-(4-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]propanamide (PubChem CID 8688198) has the molecular formula C21H31FN3O3S+ and a molecular weight of 424.56 g/mol. Its IUPAC name is (2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-[4-(4-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]propanamide.
| Compound Name | (2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-[4-(4-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 8688198 |
| Molecular Formula | C21H31FN3O3S+ |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | (2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-[4-(4-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]propanamide |
| SMILES | C[C@H](C(=O)NCCC1=CCCCC1)[NH+]1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H30FN3O3S/c1-17(21(26)23-12-11-18-5-3-2-4-6-18)24-13-15-25(16-14-24)29(27,28)20-9-7-19(22)8-10-20/h5,7-10,17H,2-4,6,11-16H2,1H3,(H,23,26)/p+1/t17-/m1/s1 |
| InChIKey | ZZEBMTODVPFDNB-QGZVFWFLSA-O |
| XLogP | 1.11 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|