C21H17NO7 — CID 9111775
(1,3-dioxoisoindol-2-yl)methyl 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxobutanoate (PubChem CID 9111775) has the molecular formula C21H17NO7 and a molecular weight of 395.37 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxobutanoate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 9111775 |
| Molecular Formula | C21H17NO7 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxobutanoate |
| SMILES | O=C(CCC(=O)c1ccc2c(c1)OCCO2)OCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H17NO7/c23-16(13-5-7-17-18(11-13)28-10-9-27-17)6-8-19(24)29-12-22-20(25)14-3-1-2-4-15(14)21(22)26/h1-5,7,11H,6,8-10,12H2 |
| InChIKey | MYAUEXGGRZZYKR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|