C22H15NO6S — CID 18156040
(1,3-dioxoisoindol-2-yl)methyl 5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophene-2-carboxylate (PubChem CID 18156040) has the molecular formula C22H15NO6S and a molecular weight of 421.43 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophene-2-carboxylate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 18156040 |
| Molecular Formula | C22H15NO6S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 5-(2,3-dihydro-1,4-benzodioxin-6-yl)thiophene-2-carboxylate |
| SMILES | O=C(OCN1C(=O)c2ccccc2C1=O)c1ccc(-c2ccc3c(c2)OCCO3)s1 |
| InChI | InChI=1S/C22H15NO6S/c24-20-14-3-1-2-4-15(14)21(25)23(20)12-29-22(26)19-8-7-18(30-19)13-5-6-16-17(11-13)28-10-9-27-16/h1-8,11H,9-10,12H2 |
| InChIKey | KIUMQPMMRKUJEI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|