C19H17NO6S — CID 158961334
benzyl 2-[5-(methylsulfonylmethyl)-1,3-dioxoisoindol-2-yl]acetate (PubChem CID 158961334) has the molecular formula C19H17NO6S and a molecular weight of 387.41 g/mol. Its IUPAC name is benzyl 2-[5-(methylsulfonylmethyl)-1,3-dioxoisoindol-2-yl]acetate.
| Compound Name | benzyl 2-[5-(methylsulfonylmethyl)-1,3-dioxoisoindol-2-yl]acetate |
|---|---|
| PubChem CID | 158961334 |
| Molecular Formula | C19H17NO6S |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | benzyl 2-[5-(methylsulfonylmethyl)-1,3-dioxoisoindol-2-yl]acetate |
| SMILES | CS(=O)(=O)Cc1ccc2c(c1)C(=O)N(CC(=O)OCc1ccccc1)C2=O |
| InChI | InChI=1S/C19H17NO6S/c1-27(24,25)12-14-7-8-15-16(9-14)19(23)20(18(15)22)10-17(21)26-11-13-5-3-2-4-6-13/h2-9H,10-12H2,1H3 |
| InChIKey | CHCZTSVZQINNPS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|