C21H18F3NO4 — CID 153066190
benzyl 3-[(1,3-dioxoisoindol-2-yl)methyl]-5,5,5-trifluoropentanoate (PubChem CID 153066190) has the molecular formula C21H18F3NO4 and a molecular weight of 405.37 g/mol. Its IUPAC name is benzyl 3-[(1,3-dioxoisoindol-2-yl)methyl]-5,5,5-trifluoropentanoate.
| Compound Name | benzyl 3-[(1,3-dioxoisoindol-2-yl)methyl]-5,5,5-trifluoropentanoate |
|---|---|
| PubChem CID | 153066190 |
| Molecular Formula | C21H18F3NO4 |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | benzyl 3-[(1,3-dioxoisoindol-2-yl)methyl]-5,5,5-trifluoropentanoate |
| SMILES | O=C(CC(CN1C(=O)c2ccccc2C1=O)CC(F)(F)F)OCc1ccccc1 |
| InChI | InChI=1S/C21H18F3NO4/c22-21(23,24)11-15(10-18(26)29-13-14-6-2-1-3-7-14)12-25-19(27)16-8-4-5-9-17(16)20(25)28/h1-9,15H,10-13H2 |
| InChIKey | VKKUDFDDXHLWPK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|