C31H26N2O4 — CID 58067100
benzyl N-[(2S)-3-(1,3-dioxoisoindol-2-yl)-1,1-diphenylpropan-2-yl]carbamate (PubChem CID 58067100) has the molecular formula C31H26N2O4 and a molecular weight of 490.56 g/mol. Its IUPAC name is benzyl N-[(2S)-3-(1,3-dioxoisoindol-2-yl)-1,1-diphenylpropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-3-(1,3-dioxoisoindol-2-yl)-1,1-diphenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 58067100 |
| Molecular Formula | C31H26N2O4 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | benzyl N-[(2S)-3-(1,3-dioxoisoindol-2-yl)-1,1-diphenylpropan-2-yl]carbamate |
| SMILES | O=C(N[C@H](CN1C(=O)c2ccccc2C1=O)C(c1ccccc1)c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C31H26N2O4/c34-29-25-18-10-11-19-26(25)30(35)33(29)20-27(32-31(36)37-21-22-12-4-1-5-13-22)28(23-14-6-2-7-15-23)24-16-8-3-9-17-24/h1-19,27-28H,20-21H2,(H,32,36)/t27-/m1/s1 |
| InChIKey | ACPQMSIVLFNTIL-HHHXNRCGSA-N |
| XLogP | 5.41 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|