C24H29N2O7P — CID 88878050
[7-(1,3-dioxoisoindol-2-yl)-1-(phenylmethoxycarbonylamino)heptyl]-methoxyphosphinic acid (PubChem CID 88878050) has the molecular formula C24H29N2O7P and a molecular weight of 488.48 g/mol. Its IUPAC name is [7-(1,3-dioxoisoindol-2-yl)-1-(phenylmethoxycarbonylamino)heptyl]-methoxyphosphinic acid.
| Compound Name | [7-(1,3-dioxoisoindol-2-yl)-1-(phenylmethoxycarbonylamino)heptyl]-methoxyphosphinic acid |
|---|---|
| PubChem CID | 88878050 |
| Molecular Formula | C24H29N2O7P |
| Molecular Weight | 488.48 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | [7-(1,3-dioxoisoindol-2-yl)-1-(phenylmethoxycarbonylamino)heptyl]-methoxyphosphinic acid |
| SMILES | COP(=O)(O)C(CCCCCCN1C(=O)c2ccccc2C1=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H29N2O7P/c1-32-34(30,31)21(25-24(29)33-17-18-11-5-4-6-12-18)15-7-2-3-10-16-26-22(27)19-13-8-9-14-20(19)23(26)28/h4-6,8-9,11-14,21H,2-3,7,10,15-17H2,1H3,(H,25,29)(H,30,31) |
| InChIKey | MJVKDOOJYBWNRQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|