C21H20N2O7 — CID 102474081
methyl (2S)-4-(1,3-dioxoisoindol-2-yl)oxy-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 102474081) has the molecular formula C21H20N2O7 and a molecular weight of 412.40 g/mol. Its IUPAC name is methyl (2S)-4-(1,3-dioxoisoindol-2-yl)oxy-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | methyl (2S)-4-(1,3-dioxoisoindol-2-yl)oxy-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 102474081 |
| Molecular Formula | C21H20N2O7 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | methyl (2S)-4-(1,3-dioxoisoindol-2-yl)oxy-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | COC(=O)[C@H](CCON1C(=O)c2ccccc2C1=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H20N2O7/c1-28-20(26)17(22-21(27)29-13-14-7-3-2-4-8-14)11-12-30-23-18(24)15-9-5-6-10-16(15)19(23)25/h2-10,17H,11-13H2,1H3,(H,22,27)/t17-/m0/s1 |
| InChIKey | FXVGMJPLZLCEIQ-KRWDZBQOSA-N |
| XLogP | 2.07 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|