C26H24N2O6 — CID 10766387
methyl (2S)-5-(1,3-dioxobenzo[de]isoquinolin-2-yl)-2-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 10766387) has the molecular formula C26H24N2O6 and a molecular weight of 460.49 g/mol. Its IUPAC name is methyl (2S)-5-(1,3-dioxobenzo[de]isoquinolin-2-yl)-2-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | methyl (2S)-5-(1,3-dioxobenzo[de]isoquinolin-2-yl)-2-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 10766387 |
| Molecular Formula | C26H24N2O6 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | methyl (2S)-5-(1,3-dioxobenzo[de]isoquinolin-2-yl)-2-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | COC(=O)[C@H](CCCN1C(=O)c2cccc3cccc(c23)C1=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H24N2O6/c1-33-25(31)21(27-26(32)34-16-17-8-3-2-4-9-17)14-7-15-28-23(29)19-12-5-10-18-11-6-13-20(22(18)19)24(28)30/h2-6,8-13,21H,7,14-16H2,1H3,(H,27,32)/t21-/m0/s1 |
| InChIKey | USYLIJVSVJNVPY-NRFANRHFSA-N |
| XLogP | 3.68 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|