C11H13F3NO5P — CID 11824259
methoxy-[2,2,2-trifluoro-1-(phenylmethoxycarbonylamino)ethyl]phosphinic acid (PubChem CID 11824259) has the molecular formula C11H13F3NO5P and a molecular weight of 327.19 g/mol. Its IUPAC name is methoxy-[2,2,2-trifluoro-1-(phenylmethoxycarbonylamino)ethyl]phosphinic acid.
| Compound Name | methoxy-[2,2,2-trifluoro-1-(phenylmethoxycarbonylamino)ethyl]phosphinic acid |
|---|---|
| PubChem CID | 11824259 |
| Molecular Formula | C11H13F3NO5P |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | methoxy-[2,2,2-trifluoro-1-(phenylmethoxycarbonylamino)ethyl]phosphinic acid |
| SMILES | COP(=O)(O)C(NC(=O)OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H13F3NO5P/c1-19-21(17,18)9(11(12,13)14)15-10(16)20-7-8-5-3-2-4-6-8/h2-6,9H,7H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | GHFLIIPNVAYJKE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|