C18H22NO5P — CID 23213402
methoxy-[3-phenyl-2-(phenylmethoxycarbonylamino)propyl]phosphinic acid (PubChem CID 23213402) has the molecular formula C18H22NO5P and a molecular weight of 363.35 g/mol. Its IUPAC name is methoxy-[3-phenyl-2-(phenylmethoxycarbonylamino)propyl]phosphinic acid.
| Compound Name | methoxy-[3-phenyl-2-(phenylmethoxycarbonylamino)propyl]phosphinic acid |
|---|---|
| PubChem CID | 23213402 |
| Molecular Formula | C18H22NO5P |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | methoxy-[3-phenyl-2-(phenylmethoxycarbonylamino)propyl]phosphinic acid |
| SMILES | COP(=O)(O)CC(Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H22NO5P/c1-23-25(21,22)14-17(12-15-8-4-2-5-9-15)19-18(20)24-13-16-10-6-3-7-11-16/h2-11,17H,12-14H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | DKIWVTKARDVSBB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|