C31H31NO8P+ — CID 67826499
[(3R)-8-(1,3-dioxoisoindol-2-yl)-1-oxo-1-phenylmethoxy-2-phenylmethoxycarbonyloctan-3-yl]-hydroxy-oxophosphanium (PubChem CID 67826499) has the molecular formula C31H31NO8P+ and a molecular weight of 576.56 g/mol. Its IUPAC name is [(3R)-8-(1,3-dioxoisoindol-2-yl)-1-oxo-1-phenylmethoxy-2-phenylmethoxycarbonyloctan-3-yl]-hydroxy-oxophosphanium.
| Compound Name | [(3R)-8-(1,3-dioxoisoindol-2-yl)-1-oxo-1-phenylmethoxy-2-phenylmethoxycarbonyloctan-3-yl]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 67826499 |
| Molecular Formula | C31H31NO8P+ |
| Molecular Weight | 576.56 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | [(3R)-8-(1,3-dioxoisoindol-2-yl)-1-oxo-1-phenylmethoxy-2-phenylmethoxycarbonyloctan-3-yl]-hydroxy-oxophosphanium |
| SMILES | O=C(OCc1ccccc1)C(C(=O)OCc1ccccc1)[C@@H](CCCCCN1C(=O)c2ccccc2C1=O)[P+](=O)O |
| InChI | InChI=1S/C31H30NO8P/c33-28-24-16-9-10-17-25(24)29(34)32(28)19-11-3-8-18-26(41(37)38)27(30(35)39-20-22-12-4-1-5-13-22)31(36)40-21-23-14-6-2-7-15-23/h1-2,4-7,9-10,12-17,26-27H,3,8,11,18-21H2/p+1/t26-/m1/s1 |
| InChIKey | YHTQRGDGMUBXKO-AREMUKBSSA-O |
| XLogP | 5.05 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.56 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|