C23H24BrNO4 — CID 160861427
tert-butyl (3R)-3-[(4-bromophenyl)methyl]-4-(1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 160861427) has the molecular formula C23H24BrNO4 and a molecular weight of 458.35 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(4-bromophenyl)methyl]-4-(1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | tert-butyl (3R)-3-[(4-bromophenyl)methyl]-4-(1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 160861427 |
| Molecular Formula | C23H24BrNO4 |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | tert-butyl (3R)-3-[(4-bromophenyl)methyl]-4-(1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | CC(C)(C)OC(=O)C[C@@H](Cc1ccc(Br)cc1)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H24BrNO4/c1-23(2,3)29-20(26)13-16(12-15-8-10-17(24)11-9-15)14-25-21(27)18-6-4-5-7-19(18)22(25)28/h4-11,16H,12-14H2,1-3H3/t16-/m1/s1 |
| InChIKey | SKNRHMPFMJWXRB-MRXNPFEDSA-N |
| XLogP | 4.64 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|