benzyl 2-(5,6-dimethoxy-2-oxo-3H-indol-1-yl)acetate

C19H19NO5 — CID 54289473

IUPACbenzyl 2-(5,6-dimethoxy-2-oxo-3H-indol-1-yl)acetate
SMILESCOc1cc2c(cc1OC)N(CC(=O)OCc1ccccc1)C(=O)C2
InChIInChI=1S/C19H19NO5/c1-23-16-8-14-9-18(21)20(15(14)10-17(16)24-2)11-19(22)25-12-13-6-4-3-5-7-13/h3-8,10H,9,11-12H2,1-2H3
InChIKeyRWMHKZIXPZTLOV-UHFFFAOYSA-N
MW341.36 g/mol
LogP2.34
Rot. Bonds6

About benzyl 2-(5,6-dimethoxy-2-oxo-3H-indol-1-yl)acetate

benzyl 2-(5,6-dimethoxy-2-oxo-3H-indol-1-yl)acetate (PubChem CID 54289473) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is benzyl 2-(5,6-dimethoxy-2-oxo-3H-indol-1-yl)acetate.

Molecular Properties

Compound Namebenzyl 2-(5,6-dimethoxy-2-oxo-3H-indol-1-yl)acetate
PubChem CID54289473
Molecular FormulaC19H19NO5
Molecular Weight341.36 g/mol
Exact Mass341.13
IUPAC Namebenzyl 2-(5,6-dimethoxy-2-oxo-3H-indol-1-yl)acetate
SMILESCOc1cc2c(cc1OC)N(CC(=O)OCc1ccccc1)C(=O)C2
InChIInChI=1S/C19H19NO5/c1-23-16-8-14-9-18(21)20(15(14)10-17(16)24-2)11-19(22)25-12-13-6-4-3-5-7-13/h3-8,10H,9,11-12H2,1-2H3
InChIKeyRWMHKZIXPZTLOV-UHFFFAOYSA-N
XLogP2.34
TPSA65.07 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500341.36
LogP ≤ 52.34
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze benzyl 2-(5,6-dimethoxy-2-oxo-3H-indol-1-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 2-(5,6-dimethoxy-2-oxo-3H-indol-1-yl)acetate?
The IUPAC name of benzyl 2-(5,6-dimethoxy-2-oxo-3H-indol-1-yl)acetate (CID 54289473) is benzyl 2-(5,6-dimethoxy-2-oxo-3H-indol-1-yl)acetate.
What is the SMILES notation for benzyl 2-(5,6-dimethoxy-2-oxo-3H-indol-1-yl)acetate?
The canonical SMILES for benzyl 2-(5,6-dimethoxy-2-oxo-3H-indol-1-yl)acetate is COc1cc2c(cc1OC)N(CC(=O)OCc1ccccc1)C(=O)C2.
What is the InChIKey of benzyl 2-(5,6-dimethoxy-2-oxo-3H-indol-1-yl)acetate?
The InChIKey is RWMHKZIXPZTLOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO5/c1-23-16-8-14-9-18(21)20(15(14)10-17(16)24-2)11-19(22)25-12-13-6-4-3-5-7-13/h3-8,10H,9,11-12H2,1-2H3.
What are the key properties of benzyl 2-(5,6-dimethoxy-2-oxo-3H-indol-1-yl)acetate?
benzyl 2-(5,6-dimethoxy-2-oxo-3H-indol-1-yl)acetate has a molecular weight of 341.36 g/mol, XLogP of 2.34, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-(5,6-dimethoxy-2-oxo-3H-indol-1-yl)acetate is sourced from PubChem (CID 54289473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).