C19H19NO5 — CID 54289473
benzyl 2-(5,6-dimethoxy-2-oxo-3H-indol-1-yl)acetate (PubChem CID 54289473) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is benzyl 2-(5,6-dimethoxy-2-oxo-3H-indol-1-yl)acetate.
| Compound Name | benzyl 2-(5,6-dimethoxy-2-oxo-3H-indol-1-yl)acetate |
|---|---|
| PubChem CID | 54289473 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | benzyl 2-(5,6-dimethoxy-2-oxo-3H-indol-1-yl)acetate |
| SMILES | COc1cc2c(cc1OC)N(CC(=O)OCc1ccccc1)C(=O)C2 |
| InChI | InChI=1S/C19H19NO5/c1-23-16-8-14-9-18(21)20(15(14)10-17(16)24-2)11-19(22)25-12-13-6-4-3-5-7-13/h3-8,10H,9,11-12H2,1-2H3 |
| InChIKey | RWMHKZIXPZTLOV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |