C23H19N3O4 — CID 102579726
benzyl 2-(2,4-dioxo-5-phenyl-1,3,5-benzotriazepin-1-yl)acetate (PubChem CID 102579726) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is benzyl 2-(2,4-dioxo-5-phenyl-1,3,5-benzotriazepin-1-yl)acetate.
| Compound Name | benzyl 2-(2,4-dioxo-5-phenyl-1,3,5-benzotriazepin-1-yl)acetate |
|---|---|
| PubChem CID | 102579726 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | benzyl 2-(2,4-dioxo-5-phenyl-1,3,5-benzotriazepin-1-yl)acetate |
| SMILES | O=C(CN1C(=O)NC(=O)N(c2ccccc2)c2ccccc21)OCc1ccccc1 |
| InChI | InChI=1S/C23H19N3O4/c27-21(30-16-17-9-3-1-4-10-17)15-25-19-13-7-8-14-20(19)26(23(29)24-22(25)28)18-11-5-2-6-12-18/h1-14H,15-16H2,(H,24,28,29) |
| InChIKey | YCAXRYFBWWVUAA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |