benzyl 2-(2,3-dioxo-5,6-dihydro-4H-1-benzazocin-1-yl)acetate

C20H19NO4 — CID 13499444

IUPACbenzyl 2-(2,3-dioxo-5,6-dihydro-4H-1-benzazocin-1-yl)acetate
SMILESO=C(CN1C(=O)C(=O)CCCc2ccccc21)OCc1ccccc1
InChIInChI=1S/C20H19NO4/c22-18-12-6-10-16-9-4-5-11-17(16)21(20(18)24)13-19(23)25-14-15-7-2-1-3-8-15/h1-5,7-9,11H,6,10,12-14H2
InChIKeyGEQOYSVTLDDDPW-UHFFFAOYSA-N
MW337.38 g/mol
LogP2.67
Rot. Bonds4

About benzyl 2-(2,3-dioxo-5,6-dihydro-4H-1-benzazocin-1-yl)acetate

benzyl 2-(2,3-dioxo-5,6-dihydro-4H-1-benzazocin-1-yl)acetate (PubChem CID 13499444) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is benzyl 2-(2,3-dioxo-5,6-dihydro-4H-1-benzazocin-1-yl)acetate.

Molecular Properties

Compound Namebenzyl 2-(2,3-dioxo-5,6-dihydro-4H-1-benzazocin-1-yl)acetate
PubChem CID13499444
Molecular FormulaC20H19NO4
Molecular Weight337.38 g/mol
Exact Mass337.13
IUPAC Namebenzyl 2-(2,3-dioxo-5,6-dihydro-4H-1-benzazocin-1-yl)acetate
SMILESO=C(CN1C(=O)C(=O)CCCc2ccccc21)OCc1ccccc1
InChIInChI=1S/C20H19NO4/c22-18-12-6-10-16-9-4-5-11-17(16)21(20(18)24)13-19(23)25-14-15-7-2-1-3-8-15/h1-5,7-9,11H,6,10,12-14H2
InChIKeyGEQOYSVTLDDDPW-UHFFFAOYSA-N
XLogP2.67
TPSA63.68 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500337.38
LogP ≤ 52.67
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze benzyl 2-(2,3-dioxo-5,6-dihydro-4H-1-benzazocin-1-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 2-(2,3-dioxo-5,6-dihydro-4H-1-benzazocin-1-yl)acetate?
The IUPAC name of benzyl 2-(2,3-dioxo-5,6-dihydro-4H-1-benzazocin-1-yl)acetate (CID 13499444) is benzyl 2-(2,3-dioxo-5,6-dihydro-4H-1-benzazocin-1-yl)acetate.
What is the SMILES notation for benzyl 2-(2,3-dioxo-5,6-dihydro-4H-1-benzazocin-1-yl)acetate?
The canonical SMILES for benzyl 2-(2,3-dioxo-5,6-dihydro-4H-1-benzazocin-1-yl)acetate is O=C(CN1C(=O)C(=O)CCCc2ccccc21)OCc1ccccc1.
What is the InChIKey of benzyl 2-(2,3-dioxo-5,6-dihydro-4H-1-benzazocin-1-yl)acetate?
The InChIKey is GEQOYSVTLDDDPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO4/c22-18-12-6-10-16-9-4-5-11-17(16)21(20(18)24)13-19(23)25-14-15-7-2-1-3-8-15/h1-5,7-9,11H,6,10,12-14H2.
What are the key properties of benzyl 2-(2,3-dioxo-5,6-dihydro-4H-1-benzazocin-1-yl)acetate?
benzyl 2-(2,3-dioxo-5,6-dihydro-4H-1-benzazocin-1-yl)acetate has a molecular weight of 337.38 g/mol, XLogP of 2.67, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-(2,3-dioxo-5,6-dihydro-4H-1-benzazocin-1-yl)acetate is sourced from PubChem (CID 13499444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).