C21H26N2O4 — CID 71925864
2-(3,4-dihydro-2H-quinolin-1-yl)ethyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate (PubChem CID 71925864) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-quinolin-1-yl)ethyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate.
| Compound Name | 2-(3,4-dihydro-2H-quinolin-1-yl)ethyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 71925864 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2-(3,4-dihydro-2H-quinolin-1-yl)ethyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetate |
| SMILES | O=C(CN1C(=O)C2CCCCC2C1=O)OCCN1CCCc2ccccc21 |
| InChI | InChI=1S/C21H26N2O4/c24-19(14-23-20(25)16-8-2-3-9-17(16)21(23)26)27-13-12-22-11-5-7-15-6-1-4-10-18(15)22/h1,4,6,10,16-17H,2-3,5,7-9,11-14H2 |
| InChIKey | MPEOJCAZOWOQSO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|