C14H12BrNO5 — CID 63896840
ethyl 4-(7-bromo-2,3-dioxoindol-1-yl)-3-oxobutanoate (PubChem CID 63896840) has the molecular formula C14H12BrNO5 and a molecular weight of 354.16 g/mol. Its IUPAC name is ethyl 4-(7-bromo-2,3-dioxoindol-1-yl)-3-oxobutanoate.
| Compound Name | ethyl 4-(7-bromo-2,3-dioxoindol-1-yl)-3-oxobutanoate |
|---|---|
| PubChem CID | 63896840 |
| Molecular Formula | C14H12BrNO5 |
| Molecular Weight | 354.16 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | ethyl 4-(7-bromo-2,3-dioxoindol-1-yl)-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)CN1C(=O)C(=O)c2cccc(Br)c21 |
| InChI | InChI=1S/C14H12BrNO5/c1-2-21-11(18)6-8(17)7-16-12-9(13(19)14(16)20)4-3-5-10(12)15/h3-5H,2,6-7H2,1H3 |
| InChIKey | ODWQJXGQBXLGJW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.16 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|