C14H13BrN2O3 — CID 60711537
7-bromo-1-(2-oxo-2-pyrrolidin-1-ylethyl)indole-2,3-dione (PubChem CID 60711537) has the molecular formula C14H13BrN2O3 and a molecular weight of 337.17 g/mol. Its IUPAC name is 7-bromo-1-(2-oxo-2-pyrrolidin-1-ylethyl)indole-2,3-dione.
| Compound Name | 7-bromo-1-(2-oxo-2-pyrrolidin-1-ylethyl)indole-2,3-dione |
|---|---|
| PubChem CID | 60711537 |
| Molecular Formula | C14H13BrN2O3 |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 7-bromo-1-(2-oxo-2-pyrrolidin-1-ylethyl)indole-2,3-dione |
| SMILES | O=C1C(=O)N(CC(=O)N2CCCC2)c2c(Br)cccc21 |
| InChI | InChI=1S/C14H13BrN2O3/c15-10-5-3-4-9-12(10)17(14(20)13(9)19)8-11(18)16-6-1-2-7-16/h3-5H,1-2,6-8H2 |
| InChIKey | CKIJWMPKANQNKG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|