C13H12BrNO2 — CID 66046443
7-bromo-1-(2-methylidenebutyl)indole-2,3-dione (PubChem CID 66046443) has the molecular formula C13H12BrNO2 and a molecular weight of 294.15 g/mol. Its IUPAC name is 7-bromo-1-(2-methylidenebutyl)indole-2,3-dione.
| Compound Name | 7-bromo-1-(2-methylidenebutyl)indole-2,3-dione |
|---|---|
| PubChem CID | 66046443 |
| Molecular Formula | C13H12BrNO2 |
| Molecular Weight | 294.15 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 7-bromo-1-(2-methylidenebutyl)indole-2,3-dione |
| SMILES | C=C(CC)CN1C(=O)C(=O)c2cccc(Br)c21 |
| InChI | InChI=1S/C13H12BrNO2/c1-3-8(2)7-15-11-9(12(16)13(15)17)5-4-6-10(11)14/h4-6H,2-3,7H2,1H3 |
| InChIKey | QNSUSWYNUHHYHS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.15 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|