C12H11FN2O2 — CID 103072739
1-[2-(aminomethyl)prop-2-enyl]-7-fluoroindole-2,3-dione (PubChem CID 103072739) has the molecular formula C12H11FN2O2 and a molecular weight of 234.23 g/mol. Its IUPAC name is 1-[2-(aminomethyl)prop-2-enyl]-7-fluoroindole-2,3-dione.
| Compound Name | 1-[2-(aminomethyl)prop-2-enyl]-7-fluoroindole-2,3-dione |
|---|---|
| PubChem CID | 103072739 |
| Molecular Formula | C12H11FN2O2 |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 1-[2-(aminomethyl)prop-2-enyl]-7-fluoroindole-2,3-dione |
| SMILES | C=C(CN)CN1C(=O)C(=O)c2cccc(F)c21 |
| InChI | InChI=1S/C12H11FN2O2/c1-7(5-14)6-15-10-8(11(16)12(15)17)3-2-4-9(10)13/h2-4H,1,5-6,14H2 |
| InChIKey | OJRDOCOLTWOHIH-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|