C17H14FN3O2S — CID 155235189
[4-[(7-fluoro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidothioate (PubChem CID 155235189) has the molecular formula C17H14FN3O2S and a molecular weight of 343.38 g/mol. Its IUPAC name is [4-[(7-fluoro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidothioate.
| Compound Name | [4-[(7-fluoro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidothioate |
|---|---|
| PubChem CID | 155235189 |
| Molecular Formula | C17H14FN3O2S |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | [4-[(7-fluoro-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCc1ccc(CN2C(=O)C(=O)c3cccc(F)c32)cc1 |
| InChI | InChI=1S/C17H14FN3O2S/c18-13-3-1-2-12-14(13)21(16(23)15(12)22)8-10-4-6-11(7-5-10)9-24-17(19)20/h1-7H,8-9H2,(H3,19,20) |
| InChIKey | FBUFZFXHXQARFI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|