C17H14BrN3O2Se — CID 155715222
[4-[(7-bromo-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate (PubChem CID 155715222) has the molecular formula C17H14BrN3O2Se and a molecular weight of 451.18 g/mol. Its IUPAC name is [4-[(7-bromo-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate.
| Compound Name | [4-[(7-bromo-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate |
|---|---|
| PubChem CID | 155715222 |
| Molecular Formula | C17H14BrN3O2Se |
| Molecular Weight | 451.18 g/mol |
| Exact Mass | 450.94 |
| IUPAC Name | [4-[(7-bromo-2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidoselenoate |
| SMILES | [H]/N=C(\N)[Se]Cc1ccc(CN2C(=O)C(=O)c3cccc(Br)c32)cc1 |
| InChI | InChI=1S/C17H14BrN3O2Se/c18-13-3-1-2-12-14(13)21(16(23)15(12)22)8-10-4-6-11(7-5-10)9-24-17(19)20/h1-7H,8-9H2,(H3,19,20) |
| InChIKey | VKCPCKLUAYTBII-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.18 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|