C15H8BrCl2NO2 — CID 65317495
7-bromo-1-[(2,5-dichlorophenyl)methyl]indole-2,3-dione (PubChem CID 65317495) has the molecular formula C15H8BrCl2NO2 and a molecular weight of 385.04 g/mol. Its IUPAC name is 7-bromo-1-[(2,5-dichlorophenyl)methyl]indole-2,3-dione.
| Compound Name | 7-bromo-1-[(2,5-dichlorophenyl)methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 65317495 |
| Molecular Formula | C15H8BrCl2NO2 |
| Molecular Weight | 385.04 g/mol |
| Exact Mass | 382.91 |
| IUPAC Name | 7-bromo-1-[(2,5-dichlorophenyl)methyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(Cc2cc(Cl)ccc2Cl)c2c(Br)cccc21 |
| InChI | InChI=1S/C15H8BrCl2NO2/c16-11-3-1-2-10-13(11)19(15(21)14(10)20)7-8-6-9(17)4-5-12(8)18/h1-6H,7H2 |
| InChIKey | VIIAPQBLRWKWGM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.04 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|