About [4-[(2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidothioate
[4-[(2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidothioate (PubChem CID 155235324) has the molecular formula C17H15N3O2S
and a molecular weight of 325.39 g/mol. Its IUPAC name is [4-[(2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidothioate.
Molecular Properties
| Compound Name | [4-[(2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidothioate |
| PubChem CID | 155235324 |
| Molecular Formula | C17H15N3O2S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | [4-[(2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCc1ccc(CN2C(=O)C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C17H15N3O2S/c18-17(19)23-10-12-7-5-11(6-8-12)9-20-14-4-2-1-3-13(14)15(21)16(20)22/h1-8H,9-10H2,(H3,18,19) |
| InChIKey | CYKKSOLROXXYGJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [4-[(2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidothioate?
The IUPAC name of [4-[(2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidothioate (CID 155235324) is [4-[(2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidothioate.
What is the SMILES notation for [4-[(2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidothioate?
The canonical SMILES for [4-[(2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidothioate is [H]/N=C(\N)SCc1ccc(CN2C(=O)C(=O)c3ccccc32)cc1.
What is the InChIKey of [4-[(2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidothioate?
The InChIKey is CYKKSOLROXXYGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3O2S/c18-17(19)23-10-12-7-5-11(6-8-12)9-20-14-4-2-1-3-13(14)15(21)16(20)22/h1-8H,9-10H2,(H3,18,19).
What are the key properties of [4-[(2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidothioate?
[4-[(2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidothioate has a molecular weight of 325.39 g/mol, XLogP of 2.54, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2,3-dioxoindol-1-yl)methyl]phenyl]methyl carbamimidothioate is sourced from PubChem (CID 155235324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).