C11H7F4NO2S — CID 116616336
7-fluoro-1-[2-(trifluoromethylsulfanyl)ethyl]indole-2,3-dione (PubChem CID 116616336) has the molecular formula C11H7F4NO2S and a molecular weight of 293.24 g/mol. Its IUPAC name is 7-fluoro-1-[2-(trifluoromethylsulfanyl)ethyl]indole-2,3-dione.
| Compound Name | 7-fluoro-1-[2-(trifluoromethylsulfanyl)ethyl]indole-2,3-dione |
|---|---|
| PubChem CID | 116616336 |
| Molecular Formula | C11H7F4NO2S |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 7-fluoro-1-[2-(trifluoromethylsulfanyl)ethyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(CCSC(F)(F)F)c2c(F)cccc21 |
| InChI | InChI=1S/C11H7F4NO2S/c12-7-3-1-2-6-8(7)16(10(18)9(6)17)4-5-19-11(13,14)15/h1-3H,4-5H2 |
| InChIKey | ZREJWNCXUZARNM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|