C22H14F6N2O4 — CID 169008038
1-[4-[2,3-dioxo-7-(trifluoromethyl)indol-1-yl]butyl]-7-(trifluoromethyl)indole-2,3-dione (PubChem CID 169008038) has the molecular formula C22H14F6N2O4 and a molecular weight of 484.35 g/mol. Its IUPAC name is 1-[4-[2,3-dioxo-7-(trifluoromethyl)indol-1-yl]butyl]-7-(trifluoromethyl)indole-2,3-dione.
| Compound Name | 1-[4-[2,3-dioxo-7-(trifluoromethyl)indol-1-yl]butyl]-7-(trifluoromethyl)indole-2,3-dione |
|---|---|
| PubChem CID | 169008038 |
| Molecular Formula | C22H14F6N2O4 |
| Molecular Weight | 484.35 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | 1-[4-[2,3-dioxo-7-(trifluoromethyl)indol-1-yl]butyl]-7-(trifluoromethyl)indole-2,3-dione |
| SMILES | O=C1C(=O)N(CCCCN2C(=O)C(=O)c3cccc(C(F)(F)F)c32)c2c1cccc2C(F)(F)F |
| InChI | InChI=1S/C22H14F6N2O4/c23-21(24,25)13-7-3-5-11-15(13)29(19(33)17(11)31)9-1-2-10-30-16-12(18(32)20(30)34)6-4-8-14(16)22(26,27)28/h3-8H,1-2,9-10H2 |
| InChIKey | VOUYXANSQRWCRD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.35 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|