About 1-nonyl-7-phenylindole-2,3-dione
1-nonyl-7-phenylindole-2,3-dione (PubChem CID 508422) has the molecular formula C23H27NO2
and a molecular weight of 349.47 g/mol. Its IUPAC name is 1-nonyl-7-phenylindole-2,3-dione.
Molecular Properties
| Compound Name | 1-nonyl-7-phenylindole-2,3-dione |
| PubChem CID | 508422 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 1-nonyl-7-phenylindole-2,3-dione |
| SMILES | CCCCCCCCCN1C(=O)C(=O)c2cccc(-c3ccccc3)c21 |
| InChI | InChI=1S/C23H27NO2/c1-2-3-4-5-6-7-11-17-24-21-19(18-13-9-8-10-14-18)15-12-16-20(21)22(25)23(24)26/h8-10,12-16H,2-7,11,17H2,1H3 |
| InChIKey | AEQJGHYAIWZFJM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-nonyl-7-phenylindole-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nonyl-7-phenylindole-2,3-dione?
The IUPAC name of 1-nonyl-7-phenylindole-2,3-dione (CID 508422) is 1-nonyl-7-phenylindole-2,3-dione.
What is the SMILES notation for 1-nonyl-7-phenylindole-2,3-dione?
The canonical SMILES for 1-nonyl-7-phenylindole-2,3-dione is CCCCCCCCCN1C(=O)C(=O)c2cccc(-c3ccccc3)c21.
What is the InChIKey of 1-nonyl-7-phenylindole-2,3-dione?
The InChIKey is AEQJGHYAIWZFJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27NO2/c1-2-3-4-5-6-7-11-17-24-21-19(18-13-9-8-10-14-18)15-12-16-20(21)22(25)23(24)26/h8-10,12-16H,2-7,11,17H2,1H3.
What are the key properties of 1-nonyl-7-phenylindole-2,3-dione?
1-nonyl-7-phenylindole-2,3-dione has a molecular weight of 349.47 g/mol, XLogP of 5.63, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nonyl-7-phenylindole-2,3-dione is sourced from PubChem (CID 508422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).