C26H26BrNO2 — CID 175135150
1,1'-biphenyl;1-(6-bromohexyl)indole-2,3-dione (PubChem CID 175135150) has the molecular formula C26H26BrNO2 and a molecular weight of 464.40 g/mol. Its IUPAC name is 1,1'-biphenyl;1-(6-bromohexyl)indole-2,3-dione.
| Compound Name | 1,1'-biphenyl;1-(6-bromohexyl)indole-2,3-dione |
|---|---|
| PubChem CID | 175135150 |
| Molecular Formula | C26H26BrNO2 |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 1,1'-biphenyl;1-(6-bromohexyl)indole-2,3-dione |
| SMILES | O=C1C(=O)N(CCCCCCBr)c2ccccc21.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C14H16BrNO2.C12H10/c15-9-5-1-2-6-10-16-12-8-4-3-7-11(12)13(17)14(16)18;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h3-4,7-8H,1-2,5-6,9-10H2;1-10H |
| InChIKey | NHOLMTHMZJIRFI-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|