C36H42N4O6 — CID 122206878
1-[8-[3-[8-(2,3-dioxoindol-1-yl)octyl]-2,4-dioxopyrimidin-1-yl]octyl]indole-2,3-dione (PubChem CID 122206878) has the molecular formula C36H42N4O6 and a molecular weight of 626.75 g/mol. Its IUPAC name is 1-[8-[3-[8-(2,3-dioxoindol-1-yl)octyl]-2,4-dioxopyrimidin-1-yl]octyl]indole-2,3-dione.
| Compound Name | 1-[8-[3-[8-(2,3-dioxoindol-1-yl)octyl]-2,4-dioxopyrimidin-1-yl]octyl]indole-2,3-dione |
|---|---|
| PubChem CID | 122206878 |
| Molecular Formula | C36H42N4O6 |
| Molecular Weight | 626.75 g/mol |
| Exact Mass | 626.31 |
| IUPAC Name | 1-[8-[3-[8-(2,3-dioxoindol-1-yl)octyl]-2,4-dioxopyrimidin-1-yl]octyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(CCCCCCCCn2ccc(=O)n(CCCCCCCCN3C(=O)C(=O)c4ccccc43)c2=O)c2ccccc21 |
| InChI | InChI=1S/C36H42N4O6/c41-31-21-26-37(22-13-5-1-2-6-14-23-38-29-19-11-9-17-27(29)32(42)34(38)44)36(46)40(31)25-16-8-4-3-7-15-24-39-30-20-12-10-18-28(30)33(43)35(39)45/h9-12,17-21,26H,1-8,13-16,22-25H2 |
| InChIKey | OCROZGPGTQSQCP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 118.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.75 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|