C13H15NO2S — CID 115659187
1-(3-ethylsulfanylpropyl)indole-2,3-dione (PubChem CID 115659187) has the molecular formula C13H15NO2S and a molecular weight of 249.33 g/mol. Its IUPAC name is 1-(3-ethylsulfanylpropyl)indole-2,3-dione.
| Compound Name | 1-(3-ethylsulfanylpropyl)indole-2,3-dione |
|---|---|
| PubChem CID | 115659187 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 1-(3-ethylsulfanylpropyl)indole-2,3-dione |
| SMILES | CCSCCCN1C(=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C13H15NO2S/c1-2-17-9-5-8-14-11-7-4-3-6-10(11)12(15)13(14)16/h3-4,6-7H,2,5,8-9H2,1H3 |
| InChIKey | OAHSWXCGCCLKKR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|