C20H18N2O2 — CID 137357540
1-(4-indol-1-ylbutyl)indole-2,3-dione (PubChem CID 137357540) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 1-(4-indol-1-ylbutyl)indole-2,3-dione.
| Compound Name | 1-(4-indol-1-ylbutyl)indole-2,3-dione |
|---|---|
| PubChem CID | 137357540 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 1-(4-indol-1-ylbutyl)indole-2,3-dione |
| SMILES | O=C1C(=O)N(CCCCn2ccc3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C20H18N2O2/c23-19-16-8-2-4-10-18(16)22(20(19)24)13-6-5-12-21-14-11-15-7-1-3-9-17(15)21/h1-4,7-11,14H,5-6,12-13H2 |
| InChIKey | IPYLFPCDUIISQW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|